| Cas No.: | 2765625-93-0 |
| Chemical Name: | SJ6986 |
| Synonyms: | SJ6986 |
| SMILES: | O=C1C2=CC(NS(C3C=CC=CC=3OC(F)(F)F)(=O)=O)=CC=C2C(=O)N1C1CCC(=O)NC1=O |
| Formula: | C20H14F3N3O7S |
| M.Wt: | 497.40 |
| Purity: | >97% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Publication: | Identification of Potent, Selective, and Orally Bioavailable Small-Molecule GSPT1/2 Degraders from a Focused Library of Cereblon Modulators. J Med Chem. 2021 06 10; 64(11):7296-7311. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
