To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
| Cas No.: | 2191110-79-7 |
| Chemical Name: | 2-Propen-1-one, 1-[7-(phenylmethyl)-2,7-diazaspiro[4.4]non-2-yl]- |
| Synonyms: | 2-Propen-1-one, 1-[7-(phenylmethyl)-2,7-diazaspiro[4.4]non-2-yl]- |
| SMILES: | C(N1CCC2(CCN(CC3=CC=CC=C3)C2)C1)(=O)C=C |
| Formula: | C17H22N2O |
| M.Wt: | 270.369384288788 |
| Purity: | 98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
