| Cas No.: | 864627-58-7 |
| Chemical Name: | Naphthyridine carbamate dimer |
| Synonyms: | NCD |
| SMILES: | O=C(NC1=NC2=C(C=C1)C=CC(C)=N2)OCCCNCCCOC(NC3=NC4=C(C=C3)C=CC(C)=N4)=O |
| Formula: | C26H29N7O4 |
| M.Wt: | 503.55 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
