| Cas No.: | 2892065-45-9 |
| Chemical Name: | PLX-4545 |
| Synonyms: | PLX-4545;PLX-4545;PLX-4545;PLX-4545;PLX-4545;2892065-45-9;2892065-45-9;2892065-45-9;2892065-45-9;2892065-45-9;2892065-45-9;EX-A9763;EX-A9763;EX-A9763;EX-A9763;EX-A9763;EX-A9763;SCHEMBL24877146;SCHEMBL24877146;SCHEMBL24877146;SCHEMBL24877146;SCHEMBL24877146;SCHEMBL24877146;(3S)-3-[3-oxo-6-[(1S,2S)-2-(3-phenylazetidin-1-yl)cyclohexyl]oxy-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES: | O(C1C=CC2C(N([C@@H]3C(NC(CC3)=O)=O)CC=2C=1)=O)[C@H]1CCCC[C@@H]1N1CC(C2C=CC=CC=2)C1 |
| Formula: | C28H31N3O4 |
| M.Wt: | 473.56 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
