| Cas No.: | 2367619-63-2 |
| Chemical Name: | 2,6-Piperidinedione, 3-[4-(3-thienyl)-1H-1,2,3-triazol-1-yl]- |
| Synonyms: | 2,6-Piperidinedione, 3-[4-(3-thienyl)-1H-1,2,3-triazol-1-yl]-;TMX-4100;CS-0371240;2367619-63-2;3-(4-thiophen-3-yltriazol-1-yl)piperidine-2,6-dione;CHEMBL5091525;HY-145321;F83835;3-(4-(Thiophen-3-yl)-1H-1,2,3-triazol-1-yl)piperidine-2,6-dione;EX-A6059;AKOS040757594;DA-78516;MS-23693;GLXC-25097;SCHEMBL22711376 |
| SMILES: | N1C(=O)CCC(N2C=C(C3C=CSC=3)N=N2)C1=O |
| Formula: | C11H10N4O2S |
| M.Wt: | 262.29 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
