| Cas No.: | 5184-64-5 |
| Chemical Name: | Benzene,1,3,5-trimethyl-2-[(4-methylphenyl)sulfonyl]- |
| Synonyms: | Benzene,1,3,5-trimethyl-2-[(4-methylphenyl)sulfonyl]-;1,3,5-trimethyl-2-(4-methylphenyl)sulfonylbenzene;AC1L6RWH;AC1Q6TOK;CHEMBL2313653;CTK4J4972;mesityl(4-methylphenyl) sulfone;MolPort-002-893-280;NSC116966;SureCN9001218 |
| SMILES: | CC1C=C(C)C=C(C)C=1S(C1C=CC(C)=CC=1)(=O)=O |
| Formula: | C16H18O2S |
| M.Wt: | 274.377923488617 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | ESI-05 (NSC 116966) is a specific exchange protein directly activated by cAMP 2 (EPAC2) antagonist (IC50, 0.4 µM), suppresses the cAMP-mediated activation of EPAC2 and inhibits Rap1 activation mediated by EAPC2[1]. |
| Target: | IC50: 0.4 µM (EPAC2)[1] |
| References: | [1]. Tsalkova T, et al. Isoform-specific antagonists of exchange proteins directly activated by cAMP. Proc Natl Acad Sci U S A. 2012 Nov 6;109(45):18613-8. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
