| Cas No.: | 89159-60-4 |
| Chemical Name: | ML-354 |
| Synonyms: | (1-Methyl-5-nitro-3-phenyl-1H-indol-2-yl)methanol;(1-methyl-5-nitro-3-phenyl-1H-indol-2-yl)methanol(SALTDATA: FREE);(1-methyl-5-nitro-3-phenylindol-2-yl)methanol;1H-Indole-2-methanol, 1-methyl-5-nitro-3-phenyl-;CHEMBRDG-BB 5280909;ML 354;1h-indole-2-methanol,1-methyl-5-nitro-3-phenyl;1-methyl-2-hydroxymethyl-3-phenyl-5-nitroindole;1-Methyl-5-nitro-3-phenyl-1H-indole-2-methanol;VU0099704 |
| SMILES: | CN1C2=C(C=C(C=C2)[N+](=O)[O-])C(=C1CO)C3=CC=CC=C3 |
| Formula: | C16H14N2O3 |
| M.Wt: | 282.29396 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | ML354 (VU0099704) is a novel potent and selective PAR4 antagonist with IC50 of 140 nM, displays 71-fold selectivity versus PAR-1; also displays improved physical properties and is very amenable to future medicinal chemistry development. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
