| Cas No.: | 55985-32-5 |
| Chemical Name: | 3,5-Pyridinedicarboxylic acid, 1,4-dihydro-2,6-dimethyl-4-(3-nitrophenyl)-, 3-methyl 5-[2-[methyl(phenylmethyl)amino]ethyl] ester |
| Synonyms: | YC-93 |
| SMILES: | CN(CCOC(=O)C1C(c2cc([N+](=O)[O-])ccc2)C(C(=O)OC)=C(C)NC=1C)Cc3ccccc3 |
| Formula: | C26H29N3O6 |
| M.Wt: | 479.525 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | Nicardipine(YC-93) is a calcium channel blocker that has been widely used to control blood pressure in severe hypertension following events such as ischemic stroke, traumatic brain injury, and intracerebral hemorrhage.HypertensionPhase 3 Clinical |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
