| Cas No.: | 2246380-70-9 |
| Chemical Name: | MAC glucuronide α-hydroxy lactone-linked SN-38 |
| SMILES: | O=C([C@@H]1[C@@H](O)[C@H](O)[C@@H](O)[C@H](OC2=CC=C(COC(N(CO[C@](C3=C(CO4)C(N5CC6=C(CC)C7=CC(O)=CC=C7N=C6C5=C3)=O)(CC)C4=O)CCS(=O)(C)=O)=O)C=C2NC(CN(C)C(CCN8C(C=CC8=O)=O)=O)=O)O1)O |
| Formula: | C50H54N6O20S |
| M.Wt: | 1091.06 |
| Sotrage: | Please store the product under the recommended conditions in the Certificate of Analysis. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
