| Cas No.: | 524699-85-2 |
| Chemical Name: | PS13 |
| Synonyms: | 1H-1,2,4-Triazole, 1,5-bis(4-methoxyphenyl)-3-(2,2,2-trifluoroethoxy)- |
| SMILES: | COC1=CC=C(C=C1)C2N(N=C(OCC(F)(F)F)N=2)C3=CC=C(OC)C=C3 |
| Formula: | C18H16N3O3F3 |
| M.Wt: | 379.33 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | PS13 is a highly potent COX-1 inhibitor (IC50=1 nM) and 1,000 times more selective for COX-1 than COX-2 (7). In non-human primates, 11C-PS13 showed selective binding to COX-1 over COX-2 in most major organs including the spleen, gastrointestinal tract, kidneys, and brain. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
