| Cas No.: | 2642079-89-6 |
| Chemical Name: | GPR52 receptor modulator 1 |
| Synonyms: | HTL0041178;CS-0867843;1-(2-(3-Fluoro-5-(trifluoromethyl)benzyl)pyridin-4-yl)-1,5,6,7-tetrahydro-4H-pyrazolo[4,3-c]pyridin-4-one;SCHEMBL24852170;GPR52 receptor modulator 1;HY-154980;BDBM50614230;2642079-89-6;CHEMBL5284353;GLXC-27090;HTL-0041178 |
| SMILES: | FC1C=C(C(F)(F)F)C=C(C=1)CC1C=C(C=CN=1)N1C2=C(C=N1)C(NCC2)=O |
| Formula: | C19H14F4N4O |
| M.Wt: | 390.334277629852 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
