| Cas No.: | 2504233-68-3 |
| Chemical Name: | (Rac)-Cemsidomide |
| Synonyms: | 2,6-Piperidinedione, 3-[6-[[4-(4-morpholinylmethyl)phenyl]methyl]-2-oxobenz[cd]indol-1(2H)-yl]-;(Rac)-Cemsidomide |
| SMILES: | N1C(=O)CCC(N2C3=C4C(C=CC=C4C2=O)=C(CC2=CC=C(CN4CCOCC4)C=C2)C=C3)C1=O |
| Formula: | C28H27N3O4 |
| M.Wt: | 469.53 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
