| Cas No.: | 50909-86-9 |
| Chemical Name: | Imidazo[1,2-a]pyrazin-3(7H)-one,6-(4-hydroxyphenyl)-2,8-bis(phenylmethyl)- |
| Synonyms: | Imidazo[1,2-a]pyrazin-3(7H)-one,6-(4-hydroxyphenyl)-2,8-bis(phenylmethyl)-;2,8-dibenzyl-6-(4-hydroxyphenyl)-7H-imidazo[1,2-a]pyrazin-3-one;2,8-Dibenzyl-6-(4-hydroxyphenyl)-imidazo[1,2-a]pyrazin-3(7H)-one;CLZN h [Coelenterazine h];Coelenterazine h;Coelenterazine-h, Synthetic;2-deoxycoelenterazine;2-Deoxycoelenterazine CLZN-h;CLZ-h;CLZN-h;coelenterazine-h;Renilla luciferin |
| SMILES: | OC(C=C1)=CC=C1C2=CN(C(C(CC3=CC=CC=C3)=N4)=O)C4=C(N2)CC5=CC=CC=C5 |
| Formula: | C26H21N3O2 |
| M.Wt: | 407.46384 |
| Purity: | >98% |
| Publication: | Monitoring neural activity with bioluminescence during natural behavior. Nat. Neurosci. 13 , 513-20, (2010) |
| Description: | Coelenterazine h is a derivative of Coelenterazine. Coelenterazine h is more sensitive to Ca2+ than is the native complex, thus providing a valuable tool for measuring small changes in Ca2+ concentrations. |
| References: | Monitoring neural activity with bioluminescence during natural behavior. Nat. Neurosci. 13 , 513-20, (2010) |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
