To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
| Cas No.: | 92557-80-7 |
| Chemical Name: | 5-Carboxyfluorescein N-succinimidyl ester |
| Synonyms: | 5-Carboxyfluorescein N-succinimidyl ester;5-FAMSE;5-CARBOXYFLUORESCEIN,SUCCINIMIDYL ESTER,5-FAM,SE;5-Carboxyfluorescein-N-hydroxysuccinimide Ester;5-Carboxyfluorescein N-hydroxy succinimide ester |
| SMILES: | O=C(C1=CC2=C(C3(C4=C(OC5=C3C=CC(O)=C5)C=C(O)C=C4)OC2=O)C=C1)ON6C(CCC6=O)=O |
| Formula: | C25H15NO9 |
| M.Wt: | 473.3879 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | 5-FAM SE is a single isomer, it is one of the most popular green fluorescent reagents used for labeling peptides, proteins and nucleotides. It has also been used to prepare various small fluorescent molecules. |