| Cas No.: | 1051487-82-1 |
| Chemical Name: | (±)-(3R*,4S*)-2-Oxo-4-phenyl-3-pyrollidinecarboxylic acid 2-[1-(3-bromophenyl)ethylidene]hydrazide |
| Synonyms: | AC 264613,AC-264613 |
| SMILES: | CC(=NNC(=O)C1C(CNC1=O)C2=CC=CC=C2)C3=CC(=CC=C3)Br |
| Formula: | C19H18BrN3O2 |
| M.Wt: | 400.27 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | AC264613 is a potent and selective protease-activated receptor 2 (PAR2) agonist (pEC50 = 7.5). Displays no activity at other PAR subtypes and exhibits no significant activity at over 30 other receptors implicated in nociception and inflammation. Stimulates PI hydrolysis, Ca2+ mobilization and cellular proliferation in vitro (pEC50 values are 6.9, 7.0 and 7.5 respectively). |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
