| Cas No.: | 2230647-37-5 |
| Chemical Name: | ATX-126(ATX-0126, lipid 10p) |
| Synonyms: | ATX126, ATX 126,ATX 0126, ATX0126,ATX100,ATX-100, ATX 100 |
| SMILES: | CCCCCCCC(CCCCCCC)OC(=O)CCCN(CCCC(=O)OC(CCCCCCC)CCCCCCC)C(=O)SCCCN(C)C |
| Formula: | C44H86N2O5S |
| M.Wt: | 755.23 |
| Purity: | ELSD-HPLC>95% |
| Sotrage: | 1 year -20°C |
| Publication: | 1. Rajappan, K., Tanis, S.P., Roberts, S., et al. Development of a safe and scalable process for the production of a high-purity thiocarbamate-based ionizable lipid as an excipient in mRNA-encapsulating lipid nanoparticles. Org. Process Res. Dev. 25(6), 1383-1390 (2021). 2. Rajappan, K., Tanis, S.P., Mukthavaram, R., et al. Property-driven design and development of lipids for efficient delivery of siRNA. J. Med. Chem. 63(21), 12992-13012 (2020). |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
