| Cas No.: | 1321514-06-0 |
| Chemical Name: | 6-(2-Chloro-6-methylpyridin-4-yl)-5-(4-fluorophenyl)-1,2,4-triazin-3-amine |
| Synonyms: | 1,2,4-Triazin-3-amine, 6-(2-chloro-6-methyl-4-pyridinyl)-5-(4-fluorophenyl)-;AZD4635;6-(2-chloro-6-methylpyridin-4-yl)-5-(4-fluorophenyl)-1,2,4-triazin-3-amine;Imaradenant;HTL1071;AZD 4635;770140J08A;6-(2-chloranyl-6-methyl-pyridin-4-yl)-5-(4-fluorophenyl)-1,2,4-triazin-3-amine;Imaradenant [INN];imaradenant (proposed INN);GTPL11153;AZD 4635 [WHO-DD];AMY16806;BCP25990;NSC802101;AZD4635 (HTL1071) |
| SMILES: | ClC1C([H])=C(C([H])=C(C([H])([H])[H])N=1)C1=C(C2C([H])=C([H])C(=C([H])C=2[H])F)N=C(N([H])[H])N=N1 |
| Formula: | C15H11ClFN5 |
| M.Wt: | 315.7327 |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | AZD4635 is a novel adenosine 2A receptor (A2AR) inhibitor with a Ki of 1.7 nM. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
