| Cas No.: | 2197188-04-6 |
| Chemical Name: | (2R,3R,3aS,7aR,9R,10R,10aS,14aR)-2,9-bis(6-amino-9H-purin-9-yl)-3,10-dihydroxydodecahydrodifuro[3,2-d:3',2'-j][1,3,7,9]tetraazacyclododecine-5,12(4H,6H)-dione |
| SMILES: | N1C[C@@]([H])2O[C@H](N3C4C(N=C3)=C(N)N=CN=4)[C@@H](O)[C@@]2([H])NC(=O)NC[C@@]([H])2O[C@H](N3C4C(N=C3)=C(N)N=CN=4)[C@@H](O)[C@@]2([H])NC1=O |
| Formula: | C22H26N14O6 |
| M.Wt: | 582.542 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | STING CDN agonist IFM Therapeutics is a synthetic cyclic dinucleotide (CDN) agonist of STING, stimulates potent immunity against cancer. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
