| Cas No.: | 515138-06-4 |
| Chemical Name: | 2-[[5-methyl-3-[2-[4-propan-2-yl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]ethyl]-1,2-benzoxazol-6-yl]oxy]acetic acid |
| Synonyms: | NPS-005;SJP-0035 |
| SMILES: | C(O)(=O)COC1C=C2ON=C(CCC3SC(C4=CC=C(C(F)(F)F)C=C4)=NC=3C(C)C)C2=CC=1C |
| Formula: | C25H23F3N2O4S |
| M.Wt: | 504.524 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | Fonadelpar (NPS-005,SJP-0035) is a potent, selective peroxisome proliferator activated receptor δ (PPARδ) agonist for the treatment of corneal disorders. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
