To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
| Cas No.: | 801227-82-7 |
| Chemical Name: | N-(5-benzylthiazol-2-yl)-2-((4,6-dimethylpyrimidin-2-yl)thio)acetamide |
| Synonyms: | SirReal 1 |
| SMILES: | C(NC1=NC=C(CC2=CC=CC=C2)S1)(=O)CSC1=NC(C)=CC(C)=N1 |
| Formula: | C18H18N4Os2 |
| M.Wt: | 370.489 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | A novel potent, selective Sirt2 inhibitor with IC50 of 3.745 uM; displays no inhibitory activity against Sirt1 and Sirt 3 (IC50>100 uM). |
