| Cas No.: | 949164-09-4 |
| Chemical Name: | (2S)-2-amino-3-[(3-fluorophenyl)-(2-phenylmethoxyphenyl)methoxy]propanoic acid |
| Synonyms: | ALX 1393;ALX1393 |
| SMILES: | C(O)(=O)[C@H](N)COC(C1=CC=CC(F)=C1)C1=CC=CC=C1OCC1=CC=CC=C1 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | ALX-1393 (ALX 1393, ALX1393) is a potent, specific GlyT2 inhibitor with Ki of <1 uM; ameliorates dynamic and static mechanical allodynia in mice with herpetic or postherpetic pain, displays antinociceptive effects on in vivo. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
