| Cas No.: | 342631-41-8 |
| Chemical Name: | (R)-Diphenyl (((1-(6-amino-9H-purin-9-yl)propan-2-yl)oxy)methyl)phosphonate |
| Synonyms: | Tenofovir Alafenamide Impurity 1 |
| SMILES: | C1C=CC=C(OP(OC2=CC=CC=C2)(=O)CO[C@@H](CN2C=NC3=C(N=CN=C23)N)C)C=1 |
| Formula: | C21H22N5O4P |
| M.Wt: | 439.404 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
