| Cas No.: | |
| Chemical Name: | Lipid A4B4-S3 |
| Synonyms: | Lipid A4B4 S3 |
| SMILES: | CCCCCCCC/C=C\CCCCCCCCNC(=O)C(CCCCCOC(=O)C(CCCCCC)CCCCCCCC)OC(=O)CCCN(C)C |
| Formula: | C47H90N2O5 |
| M.Wt: | 762.68 |
| Purity: | ELSD-HPLC>95% |
| Sotrage: | 1 year -20°C |
| Publication: | Rational design and modular synthesis of biodegradable ionizable lipids via the Passerini reaction for mRNA delivery-Yue Xu # 1, Fanglin Gong # 2, Alex Golubovic # 1, Amy Strilchuk 1, Jingan Chen 2, Muye Zhou 1, Songtao Dong 1, Breanna Seto 3, Bowen LiProc Natl Acad Sci U S A . 2025 Feb 4;122(5):e2409572122. doi: 10.1073/pnas.2409572122. Epub 2025 Jan 30. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
