| Cas No.: | |
| Chemical Name: | KC-34(SPC-A9) |
| Synonyms: | KC34, SPC-A9,KC 34 |
| SMILES: | O=C1NC(CCC(=O)NCCN(CCCCCCCCC)CCCCCCCCC)C(=O)NC1CCC(=O)NCCN(CCCCCCCCC)CCCCCCCCC |
| Formula: | C50H98N6O4 |
| M.Wt: | 846.76 |
| Purity: | ELSD-HPLC>95% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Publication: | Hatit M Z C, Lokugamage M P, Dobrowolski C N, et al. Substituting racemic ionizable lipids with stereopure ones improves the efficiency of lipid nanoparticles for mRNA delivery[J]. Nature Biomedical Engineering, 2023, 7(2): 134–146. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
.png)