| Cas No.: | 1008763-54-9 |
| Chemical Name: | 3-(2-Aminoethyl)-1-((1R,2S,5R)-2-isopropyl-5-methylcyclohexanecarbonyl)-5-methoxy-1H-benzo[d]imidazol-2(3H)-one |
| Synonyms: | D-3263 (hydrochloride);D3263 hydrochloride;3-(2-aminoethyl)-1-((1R,2S,5R)-2-isopropyl-5-methylcyclohexanecarbonyl)-5-methoxy-1H-benzo[d]imidazol-2(3H)-one;3-(2-aminoethyl)-1-((1R,2S,5R)-2-isopropyl-5-methylcyclohexane-1-carbonyl)-5-methoxy-1,3-dihydro-2H-benzo[d]imidazol-2-one;70FBL3TX3E;SB17275;2H-Benzimidazol-2-one, 3-(2-aminoethyl)-1,3-dihydro-5-methoxy-1-(((;D-3263 hydrochloride |
| SMILES: | O=C([C@]1([H])C([H])([H])[C@]([H])(C([H])([H])[H])C([H])([H])C([H])([H])[C@]1([H])C([H])(C([H])([H])[H])C([H])([H])[H])N1C(N(C([H])([H])C([H])([H])N([H])[H])C2C([H])=C(C([H])=C([H])C1=2)OC([H])([H])[H])=O |
| Formula: | C21H31N3O3 |
| M.Wt: | 373.4891 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | D-3263 hydrochloride is an enteric-coated, orally bioavailable (transient receptor potential melastatin member 8) TRPM8 agonist. |
| In Vitro: | D-3263 hydrochloride binds to and activates TRPM8, which may result in an increase in calcium and sodium entry; the disruption of calcium and sodium homeostasis; and the induction of cell death in TRPM8-expressing tumor cells. D-3263 hydrochloride may decrease dihydrotestosterone (DHT) levels, which may contribute to its inhibitory effects on prostate cancer and BPH[1]. |
| References: | [1]. enteric-coated TRPM8 agonist D-3263 hydrochloride |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
