| Cas No.: | 863971-53-3 |
| SMILES: | CC(C)[C@@H](C(=O)N[C@@H](CCCNC(=O)N)C(=O)NC1=CC=C(C=C1)COC(=O)OC2=CC=C(C=C2)[N+](=O)[O-])NC(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35 |
| Formula: | C40H42N6O10 |
| M.Wt: | 766.8 |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | Fmoc-Val-Cit-PAB-PNP is a peptide prodrug linker, is a linker for antibody-drug-conjugation (ADC). |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
