| Cas No.: | 2274819-46-2 |
| Chemical Name: | 6-Methyl-5-N-[3-(7H-purin-6-yl)pyridin-2-yl]-1-N-[3-(trifluoromethoxy)phenyl]isoquinoline-1,5-diamine |
| Synonyms: | LUT014;ZB1544;N5-(3-(9H-purin-6-yl)pyridin-2-yl)-6-methyl-N1-(3-(trifluoromethoxy)phenyl)isoquinoline-1,5-diamine;6-Methyl-5-N-[3-(7H-purin-6-yl)pyridin-2-yl]-1-N-[3-(trifluoromethoxy)phenyl]isoquinoline-1,5-diamin |
| SMILES: | FC(OC1=C([H])C([H])=C([H])C(=C1[H])N([H])C1C2C([H])=C([H])C(C([H])([H])[H])=C(C=2C([H])=C([H])N=1)N([H])C1=C(C([H])=C([H])C([H])=N1)C1=C2C(=NC([H])=N1)N=C([H])N2[H])(F)F |
| Formula: | C27N8OF3H19 |
| M.Wt: | 528.488 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | LUT014 is a B-Raf inhibitor with an IC50 of 11.7 nM, extracted from patent WO 2019026065A2 [1]. |
| References: | [1]. Noa Shelach. Novel braf inhibitors and use there of for treatment of cutaneous reactions. WO2019026065A2. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
