| Cas No.: | 138117-50-7 |
| Chemical Name: | Benzoic acid,4-[[3-(1,6-dihydro-6-oxo-9H-purin-9-yl)-1-oxopropyl]amino]- |
| SMILES: | OC(=O)C1=CC=C(C=C1)NC(=O)CCN2C3=C(N=C2)C(=O)NC=N3 |
| Formula: | C15H13N5O4 |
| M.Wt: | 327.29482 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | Leteprinim (Neotrofin, AIT-082) is a hypoxanthine derivative drug with neuroprotective and nootropic effects.It stimulates release of nerve growth factors and enhances survival of neurons in the brain,and is under development as a potential treatment for neurodegenerative disorders such as Alzheimer's disease, Parkinson's disease and stroke. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
