| Cas No.: | 185298-58-2 |
| Chemical Name: | 2-(4-(2-Amino-2-oxoethoxy)-1-benzyl-2-ethyl-1H-indol-3-yl)-2-oxoacetamide |
| Synonyms: | 2-(4-(2-amino-2-oxoethoxy)-1-benzyl-2-ethyl-1H-indol-3-yl)-2-oxoacetamide;hnps-PLA Inhibitor;MDK-8582(Hnps-PLA Inhibitor);BCP17761;BDBM50055402;2-(1-Benzyl-4-carbamoylmethoxy-2-ethyl-1H-indol-3-yl)-2-oxo-acetamide;2-{[1-benzyl-3-(carbamoylcarbonyl)-2-ethyl-1H-indol-4-yl]oxy}acetamide |
| SMILES: | O(C([H])([H])C(N([H])[H])=O)C1=C([H])C([H])=C([H])C2=C1C(C(C(N([H])[H])=O)=O)=C(C([H])([H])C([H])([H])[H])N2C([H])([H])C1C([H])=C([H])C([H])=C([H])C=1[H] |
| Formula: | C21N3O4H21 |
| M.Wt: | 379.4091 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | MDK-8582, also known as Hnps-PLA Inhibitor, is an nhibitor of human nonpancreatic secretory Phospholipase A (hnps-PLA). The best one inhibited hnps-PLA(2) and LTA(4)H-h with IC(50) values of 9.2 ± 0.5 μM and 2.4 ± 1.4 μM, respectively. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
