| Cas No.: | 371934-59-7 |
| Chemical Name: | PIK-inhibitors |
| Synonyms: | PIK-inhibitors;MDK34597;3-[4-(4-Morpholinyl)pyrido[3',2':4,5]furo[3,2-d]pyrimidin-2-yl]-benzenamine;3-(8-Morpholin-4-yl-9-oxa-1,5,7-triaza-fluoren-6-yl)-phenylamine;MDK34597 (PI3K inhibitor);BCP25529;BDBM50207167;3-(4-morpholin-4-yl-pyrido[3'',2'':4,5]furo[3,2-d]pyrimidin-2-yl)-phenylaminedihydrochloride |
| SMILES: | O1C([H])([H])C([H])([H])N(C2C3=C(C4C([H])=C([H])C([H])=NC=4O3)N=C(C3C([H])=C([H])C([H])=C(C=3[H])N([H])[H])N=2)C([H])([H])C1([H])[H] |
| Formula: | C19N5O2H17 |
| M.Wt: | 347.3706 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | MDK34597 is a PI3K inhibitor.MDK34597 is an analog of PI-103 and acts as a dual PI3K/mTOR Inhibitor. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
