| Cas No.: | |
| Chemical Name: | A28-C6B2 |
| Synonyms: | A28C6B2, A28 C6B2 |
| SMILES: | CCCCCCC(COC(CCCCCN(CCCCCC(OCC(CCCC)CCCCCC)=O)CCCCCO)=O)CCCC |
| Formula: | C41H81NO5 |
| M.Wt: | 668.1 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Publication: | Ren, Y., Zeng, L., Tang, Y., et al. Enhancing spleen-targeted mRNA delivery with branched biodegradable tails in lipid nanoparticles. J. Mater. Chem. B. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
