| Cas No.: | |
| Chemical Name: | 6-(6-((4-(2-((2-(2,6-Dioxopiperidin-3-yl)-1,3-dioxoisoindolin-4-yl)oxy)acetamido)butyl)carbamoyl)pyridin-3-yl)-N-methyl-4-(phenylamino)quinoline-3-carboxamide |
| Synonyms: | aTAG 2139, aTAG2139, aTAG-2139, CFT2139, CFT-2139, CFT 2139 |
| SMILES: | O=C(CCC1N2C(C3=C(C(OCC(NCCCCNC(C4=CC=C(C5=CC=C(N=CC(C(NC)=O)=C6NC7=CC=CC=C7)C6=C5)C=N4)=O)=O)=CC=C3)C2=O)=O)NC1=O |
| Formula: | C42H38N8O8 |
| M.Wt: | 782.81 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
