| Cas No.: | 1448706-15-7 |
| Chemical Name: | Amgen-23 |
| Synonyms: | 2-Piperidinemethanol, 1-[2-[4-[[4-(3,4-dichlorophenyl)-2-thiazolyl]amino]phenyl]ethyl]-4-hydroxy-, (2R,4S)-;Amgen-23 |
| SMILES: | N1(CCC2=CC=C(NC3=NC(C4=CC=C(Cl)C(Cl)=C4)=CS3)C=C2)CC[C@H](O)C[C@@H]1CO |
| Formula: | C23H25Cl2N3O2S |
| M.Wt: | 478.43 |
| Purity: | 98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
