| Cas No.: | 442522-48-7 |
| Chemical Name: | miR-21 inhibitor 12 |
| Synonyms: | miR-21-IN-12 |
| SMILES: | COC1=CC=C(OCC(=O)NC2=CC=C(C3=NC4=C(C=CC(Cl)=C4)O3)C=C2)C=C1 |
| Formula: | C22H17ClN2O4 |
| M.Wt: | 408.838 |
| Purity: | 98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
