| Cas No.: | 1052089-16-3 |
| Chemical Name: | PSB06126 sodium |
| Synonyms: | PSB-06126; PSB 06126; PSB06126; PSB06126 sodium; |
| SMILES: | O=C(C1=C2C=CC=C1)C3=C(NC4=C5C=CC=CC5=CC=C4)C=C(S(=O)([O-])=O)C(N)=C3C2=O.[Na+] |
| Formula: | C24H15N2NaO5S |
| M.Wt: | 466.443 |
| Purity: | 98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
