| Cas No.: | 2114324-48-8 |
| Chemical Name: | Danavorexton |
| Synonyms: | Danavorexton;1QMD83K4YN;Danavorexton [INN];TAK925;GTPL11448;US10287305, Example 5;BDBM386067;BDBM386216;Example 5 [US10287305];US10287305, Example 191;(2R,3S)-Methyl 3-(methylsulfonamido)-2-(((cis-4-phenylcyclohexyl)oxy)methyl)piperidine-1-carboxylate;1-Piperidinecarboxylic acid, 3-((methylsulfonyl)amino)-2-(((cis-4-phenylcyclohexyl)oxy)methyl)-, methyl ester, (2R,3S)-;methyl (2R,3S)-3- ((methylsulfonyl)amino)-2-(((cis-4- phenylcyclohexyl)oxy) |
| SMILES: | C1=CC=CC([C@@H]2CC[C@H](OC[C@H]3[C@@H](NS(=O)(=O)C)CCCN3C(OC)=O)CC2)=C1 |
| Formula: | C21H32N2O5S |
| M.Wt: | 424.55 |
| Purity: | 98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
