| Cas No.: | 946347-36-0 |
| Chemical Name: | UHRF1 PHD inhibitor MLD5 |
| SMILES: | CN1CCC2=CC(C(CNS(=O)(=O)C3=CC=C4OCCOC4=C3)N3CCOCC3)=CC=C21 |
| Formula: | C23H29N3O5S |
| M.Wt: | 459.561 |
| Purity: | >97% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Publication: | 1. Wallace H Liu, et al. Biochemistry. 2022 Feb 10. |
| Description: | UHRF1 PHD inhibitor MLD5 is a specific compound that selectively inhibits the UHRF1-histone interaction (IC50=7.4 uM), targets the PHD finger of UHRF1, specifically disrupting histone H3 arginine 2 interactions with the PHD finger.UHRF1 PHD inhibitor MLD5 inhibited binding between H3K9me3(FAM) and UHRF1 with IC50 of 24-26 uM, displace UHRF1-histone H3 binding in cells. |
| References: | 1. Wallace H Liu, et al. Biochemistry. 2022 Feb 10. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
