| Cas No.: | 2765519-47-7 |
| Chemical Name: | VL422 |
| Synonyms: | octanedioic acid, 1,1′-[2-[[[[3-(diethylamino)propoxy]carbonyl]oxy]methyl]-1,3-propanediyl] 8,8′-bis(1-octylnonyl) ester,VL-422, VL 422 |
| SMILES: | CCCCCCCCC(CCCCCCCC)OC(CCCCCCC(OCC(COC(OCCCN(CC)CC)=O)COC(CCCCCCC(OC(CCCCCCCC)CCCCCCCC)=O)=O)=O)=O |
| Formula: | C62H117NO11 |
| M.Wt: | 1052.6 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Publication: | Rajeev, K.G., Biswas, S., Kasiewicz, L.N., et al. Lipid formulations for gene editing. 1-312 (2022). |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
