| Cas No.: | 861139-16-4 |
| SMILES: | O=S(C1=CC=C(OC)C(C2=NN=C3N2N=C(C)C4=C3C=CC=C4)=C1)(N(CCO)C)=O |
| Formula: | C20H21N5O4S |
| M.Wt: | 427.48 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | In Vitro The concentration of P13 that reduces the number of RSV plaques in HEp-2 cells by 50% (IC50) is 0.11 μM. The concentration of P13 that reduces the viability of HEp-2 by 50% (CC50) is 310 μM. Note that some cytotoxicity of P13 observed at 500 μM might be due to DMSO solvent. Hence, the selective index (CC50/IC50) values is 2818 for P13. Note that even at the relatively high concentrations P13 does not completely block the development of RSV plaques. These escape plaques are of smaller size and of non-syncytial phenotype as compared to plaques formed in the absence of inhibitor. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
