| Cas No.: | 473382-39-7 |
| Synonyms: | Akt-I-1,AktI1 |
| SMILES: | CC(C)(CNC1=NN2C(=NN=C2C3=CC=CC=C3)C=C1C4CCC4)CN(C)C |
| Formula: | C22H30N6 |
| M.Wt: | 378.5 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | The compound (Akt-I-1) inhibits only Akt1 (IC50 4.6 μM) and does not inhibit AKT2, or AKT3. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
