| Cas No.: | 261717-23-1 |
| Chemical Name: | 1H-Purine-2,6-dione, 3,7-dihydro-8-[(1E)-2-(3-methoxyphenyl)ethenyl]-7-methyl-3-[3-(phosphonooxy)propyl]-1-(2-propynyl)-, disodium salt (9CI) |
| SMILES: | [Na+].[Na+].N(C)1C2=C(N(CCCOP([O-])([O-])=O)C(=O)N(CC#C)C2=O)N=C1/C=C/C1=CC=CC(OC)=C1 |
| Formula: | C21H21N4Na2O7P |
| M.Wt: | 518.373 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
