| Cas No.: | 2113617-02-8 |
| Chemical Name: | (R)-5-(2-((5-cyano-2-methyl-4-(2-morpholinoethyl)phenyl)amino)pyrimidin-4-yl)-3-(hydroxymethyl)-3-methylindoline-7-carbonitrile |
| Synonyms: | MAP3K14 inhibitor |
| SMILES: | N1C2=C(C=C(C3C=CN=C(NC4=CC(C#N)=C(CCN5CCOCC5)C=C4C)N=3)C=C2C#N)[C@@](CO)(C)C1 |
| Formula: | C29H31N7O2 |
| M.Wt: | 509.614 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | A novel potent MAP3K14 kinase inhibitor with IC50 of 1.8 nM (NIK autophosphorylation); inhibits p-IKKα levels of L363 (NIK translocated multiple myeloma) cells with IC50 of 1.3 nM; exhibits antiproliferative activity on JJN-3 (NIK translocated) multiple myeloma cells (IC50=29 nM). |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
