| Cas No.: | 2146094-22-4 |
| Chemical Name: | 3-(4-(2'-(N-(tert-butyl)sulfamoyl)-[1,1'-biphenyl]-3-carboxamido)phenyl)propanoic acid |
| SMILES: | C(O)(=O)CCC1=CC=C(NC(C2C=CC=C(C3=CC=CC=C3S(NC(C)(C)C)(=O)=O)C=2)=O)C=C1 |
| Formula: | C26H28N2O5S |
| M.Wt: | 480.579 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | A novel compound that disrupts the HIV-1 integrase LEDGF interaction; produces an ALLINI-like phenotype through engagement of IN sites distinct from the LEDGF pocket. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
