| Cas No.: | 1082743-32-5 |
| Chemical Name: | 4H-Pyrazolo(3,4-d)pyrimidin-4-one, 1-cyclopentyl-1,5-dihydro-6-((3S,4S)-4-methyl-1-(6-quinoxalinylmethyl)-3-pyrrolidinyl)- |
| Synonyms: | PF-04181366;PF04181366;PF4181366 |
| SMILES: | C([C@@H]1[C@@H](C)CN(CC2=CC=C3C(=C2)N=CC=N3)C1)1NC(=O)C2C=NN(C3CCCC3)C=2N=1 |
| Formula: | C24H27N7O |
| M.Wt: | 429.53 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | A potent, selective, brain penetrant PDE9A inhibitor with IC50 of 1.8 nM; displays >25-fold selectivity over other PDEs. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
