| Cas No.: | 145915-58-8 |
| Chemical Name: | 1H-Isoindole-1,3(2H)-dione,5,6-bis(phenylamino)- |
| Synonyms: | 1H-Isoindole-1,3(2H)-dione,5,6-bis(phenylamino)-;CGP 52411;CGP-52411;DAPH;4,5-Dianilinophthalimide;5,6-Bis(phenylamino)-1H-isoindole-1,3(2H)-dione;DAPH/CGP 52411;4,5-Dianilinophthalimide, 5,6-Bis(phenylamino)-1H-isoindole-1,3(2H)-dione, CGP 52411 |
| SMILES: | O=C1NC(=O)C2=CC(=C(C=C12)NC1C=CC=CC=1)NC1C=CC=CC=1 |
| Formula: | C20H15N3O2 |
| M.Wt: | 329.352004289627 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | DAPH-1 (CGP 52411) is a small molecule that directly inhibits prion protein Sup35 prionogenesis with IC50 of 0.58 uM, inhibits and reverses the formation of Aβ42 fibers and reduces their toxicity to neurons in culture; inhibits prion nucleation by preventing both Head-to-Head and Tail-to-Tail intermolecular interactions; also is a potent and selective inhibitor of EGFR kinase with IC50 of 1 uM, selectively inhibits both ligand-induced EGF-R and p185c-erbB2 autophosphorylation and c-fos mRNA induction. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
