| Cas No.: | 50-24-8 |
| Chemical Name: | Pregna-1,4-diene-3,20-dione, 11,17,21-trihydroxy-, (11β)- |
| SMILES: | OCC([C@]1(CC[C@]2([C@@]3(CCC4=CC(C=C[C@]4(C)[C@@]3([H])[C@H](C[C@]12C)O)=O)[H])[H])O)=O |
| Formula: | C21H28O5 |
| M.Wt: | 360.444 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | Prednisolone is a glucocorticoid with the general properties of the corticosteroids. Allergy Approved |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
