| Cas No.: | 133718-30-6 |
| Chemical Name: | Acetamide, N-cyclohexyl-N-methyl-2-[[(Z)-[phenyl(1,2,3,5-tetrahydro-2-oxoimidazo[2,1-b]quinazolin-7-yl)methylene]amino]oxy]- |
| Synonyms: | R 80123;R80123 |
| SMILES: | O=C(N(C1CCCCC1)C)CO/N=C(/C1=CC=C2N=C3NC(=O)CN3CC2=C1)\C1=CC=CC=C1 |
| Formula: | C26H29N5O3 |
| M.Wt: | 459.5402 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | The Z-isomer of R 79595, a highly selective PDE inhibitor, 10-fold more potent than R 79595. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
