| Cas No.: | 346688-38-8 |
| Chemical Name: | 4-(3-(methylsulfonyl)phenyl)-1-propylpiperidin |
| Synonyms: | ACR16;FR-310826;ASP-2314;Huntexil |
| SMILES: | CS(C1=CC=CC(C2CCN(CCC)CC2)=C1)(=O)=O |
| Formula: | C15H23NO2S |
| M.Wt: | 281.414 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | Pridopidine (ACR16, FR-310826, ASP-2314, Huntexil) is a specific dopamine stabilizer without no partial agonism; shows robust dose-dependent striatal D2 occupancy with ED50 of 18.99 mg/kg s.c. in vivo, shows high in vivo D2 receptor occupancy, antipsychotic-like efficacy, and low potential for motor side effects in rats.Parkinson DiseaseDiscontinued |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
