| Cas No.: | 148554-65-8 |
| Chemical Name: | 2-Piperidinecarboxylic acid, 1-[oxo[tetrahydro-2-hydroxy-6-[14-hydroxy-22-(4-hydroxy-3-methoxycyclohexyl)-2,13-dimethoxy-3,9,11,15,17,21-hexamethyl-12,18-dioxo-3,5,7,15,19-docosapentaenyl]-3-methyl-2H-pyran-2-yl]acetyl]-, monosodium salt, [2R-[2α,2(S*),3α |
| Synonyms: | Secorapamycin A monosodium |
| SMILES: | [Na+].CO[C@@H]1C[C@H](C[C@H](/C=C/C([C@@H](/C=C(/[C@H]([C@H](C([C@@H](C[C@@H](/C=C/C=C/C=C(/[C@H](C[C@@H]2CC[C@@H](C)[C@@](C(C(N3CCCC[C@H]3C([O-])=O)=O)=O)(O)O2)OC)\C)C)C)=O)OC)O)\C)C)=O)C)CC[C@H]1O |
| Formula: | C51H78NNaO13 |
| M.Wt: | 936.1537 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | Seco-rapamycin is the first in vivo open-ring metabolite of rapamycin that does not affect mTOR. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
