| Cas No.: | 532959-63-0 |
| Chemical Name: | N-[4-(4-Amino-2-ethyl-1H-imidazo[4,5-c]quinolin-1-yl)butyl]methanesulfonamide |
| Synonyms: | PF 4878691;S 32865;852A;3M 001 |
| SMILES: | CS(NCCCCN1C2C3C(N=C(N)C=2N=C1CC)=CC=CC=3)(=O)=O |
| Formula: | C17H23N5O2S |
| M.Wt: | 361.46 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | PF-4878691 is a potent and selective Toll-like receptor 7 (TLR7) agonist. |
| Target: | TLR7[1] |
| References: | [1]. Fidock MD, et al. The innate immune response, clinical outcomes, and ex vivo HCV antiviral efficacy of a TLR7 agonist (PF-4878691). Clin Pharmacol Ther. 2011 Jun;89(6):821-9. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
